Record Information
public_id FDB001946
Chemical Information
name L-Leucine
description Flavouring ingredient; dietary supplement, nutrient
cas_number 61-90-5
Properties
created_at 2010-04-08 22:05:10
updated_at 2011-11-24 16:41:13
moldb_smiles CC(C)CC(N)C(O)=O
moldb_formula C6H13NO2
moldb_average_mass 131.1729
moldb_inchi InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)
moldb_mono_mass 131.094628665
moldb_inchikey InChIKey=ROHFNLRQFUQHCH-UHFFFAOYSA-N
moldb_iupac 2-amino-4-methylpentanoic acid
Structure Thumb
Synonyms
Synonym Source
α-amino-α-aminoisocaproic acid biospider
α-amino-«gamma»-methylvaleric acid biospider
α-aminoisocaproic acid biospider
(2S)-2-Amino-4-methylpentanoate biospider
(S)-2-Amino-4-methyl-pentanoic acid biospider
(S)-2-Amino-4-methylpentanoate biospider
(S)-2-Amino-4-methylvalerate biospider
2-Amino-4-methyl-valeric acid biospider
S-2-Amino-4-methylpentanoic acid biospider
L-2-Amino-4-methylvaleric acid biospider
4-methyl-L-Norvaline biospider
L-2-Amino-4-methylpentanoic acid biospider
L-a-aminoisocaproate biospider
L-alpha-aminoisocaproate biospider
L-alpha-aminoisocaproic acid biospider
L-leucine biospider
L-Norvaline, 4-methyl- biospider
FEMA 3297 db_source
Leucine, 9CI, USAN; L-form db_source