Record Information
public_id FDB012760
Chemical Information
name (Z,Z)-9,12-Octadecadienoic acid
description Constit. of most vegetable oils and animal fats. The Fe salt is the major component of metallic drier compositions used to line food cans Linoleic acid is one of two essential fatty acids that humans and other animals must ingest for good health, because the body requires them for various biological processes, but cannot synthesize them from other food components. (Wikipedia)
cas_number 60-33-3
Properties
created_at 2010-04-08 22:10:21
updated_at 2011-11-24 16:41:47
moldb_smiles CCCCC\C=C/C\C=C\CCCCCCCC(O)=O
moldb_formula C18H32O2
moldb_average_mass 280.4455
moldb_inchi InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9+
moldb_mono_mass 280.240230268
moldb_inchikey InChIKey=OYHQOLUKZRVURQ-IXWMQOLASA-N
moldb_iupac (9E,12Z)-octadeca-9,12-dienoic acid
Structure Thumb
Synonyms
Synonym Source
(9Z,12Z)-9,12-Octadecadienoate biospider
(9Z,12Z)-9,12-Octadecadienoic acid biospider
(9Z,12Z)-Octadecadienoic acid biospider
(Z,Z)-9,12-Octadecadienoate biospider
(Z,Z)-9,12-Octadecadienoic acid biospider
9,12-Linoleic acid biospider
9,12-Octadecadienoic acid (Z,Z)- biospider
9-(Z), 12-(Z)-Octadecadienoic acid biospider
9-cis,12-cis-Linoleate biospider
9-cis,12-cis-Linoleic acid biospider
9-cis,12-cis-Octadecadienoate biospider
9-cis,12-cis-Octadecadienoic acid biospider
9Z,12Z-Linoleate biospider
9Z,12Z-Linoleic acid biospider
9Z,12Z-Octadecadienoate biospider
9Z,12Z-Octadecadienoic acid biospider
all-cis-9,12-Octadecadienoate biospider
all-cis-9,12-Octadecadienoic acid biospider
cis, cis-9,12-Octadecadienoic acid biospider
cis,cis-9,12-octadecadienoic acid biospider
Cis,cis-linoleate biospider
Cis,cis-linoleic acid biospider
cis-9,cis-12-Octadecadienoate biospider
cis-9,cis-12-Octadecadienoic acid biospider
cis-9-cis-12-Octadecadienoic acid biospider
Linoleic acid db_source
Leinolic acid db_source
Telfairic acid db_source
Linolic acid db_source